C8H6Br4S2 — CID 140570962
1,1,1,1-tetrabromo-2-thiophen-2-ylthiophene (PubChem CID 140570962) has the molecular formula C8H6Br4S2 and a molecular weight of 485.89 g/mol. Its IUPAC name is 1,1,1,1-tetrabromo-2-thiophen-2-ylthiophene.
| Compound Name | 1,1,1,1-tetrabromo-2-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 140570962 |
| Molecular Formula | C8H6Br4S2 |
| Molecular Weight | 485.89 g/mol |
| Exact Mass | 481.66 |
| IUPAC Name | 1,1,1,1-tetrabromo-2-thiophen-2-ylthiophene |
| SMILES | BrS1(Br)(Br)(Br)C=CC=C1c1cccs1 |
| InChI | InChI=1S/C8H6Br4S2/c9-14(10,11,12)6-2-4-8(14)7-3-1-5-13-7/h1-6H |
| InChIKey | PNMHACCXDIWWCC-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.89 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |