C35H29IrN3-2 — CID 140591565
iridium;N-(2-methylidenebutylidene)-3-phenylbenzene-6-ide-1-carboximidamide;2-(3-phenylbenzene-6-id-1-yl)pyridine (PubChem CID 140591565) has the molecular formula C35H29IrN3-2 and a molecular weight of 683.86 g/mol. Its IUPAC name is iridium;N-(2-methylidenebutylidene)-3-phenylbenzene-6-ide-1-carboximidamide;2-(3-phenylbenzene-6-id-1-yl)pyridine.
| Compound Name | iridium;N-(2-methylidenebutylidene)-3-phenylbenzene-6-ide-1-carboximidamide;2-(3-phenylbenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 140591565 |
| Molecular Formula | C35H29IrN3-2 |
| Molecular Weight | 683.86 g/mol |
| Exact Mass | 684.20 |
| IUPAC Name | iridium;N-(2-methylidenebutylidene)-3-phenylbenzene-6-ide-1-carboximidamide;2-(3-phenylbenzene-6-id-1-yl)pyridine |
| SMILES | [H]/N=C(/N=C\C(=C)CC)c1[c-]ccc(-c2ccccc2)c1.[Ir].[c-]1ccc(-c2ccccc2)cc1-c1ccccn1 |
| InChI | InChI=1S/C18H17N2.C17H12N.Ir/c1-3-14(2)13-20-18(19)17-11-7-10-16(12-17)15-8-5-4-6-9-15;1-2-7-14(8-3-1)15-9-6-10-16(13-15)17-11-4-5-12-18-17;/h4-10,12-13,19H,2-3H2,1H3;1-9,11-13H;/q2*-1;/b19-18+,20-13-;; |
| InChIKey | DSIOYJKAHXAQLH-MPVUREIWSA-N |
| XLogP | 8.73 |
| TPSA | 49.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.86 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|