C28H22NO6PSe — CID 140617165
dibenzyl (6-selenophen-2-yl-[1,3]dioxolo[4,5-g]quinolin-8-yl) phosphate (PubChem CID 140617165) has the molecular formula C28H22NO6PSe and a molecular weight of 578.42 g/mol. Its IUPAC name is dibenzyl (6-selenophen-2-yl-[1,3]dioxolo[4,5-g]quinolin-8-yl) phosphate.
| Compound Name | dibenzyl (6-selenophen-2-yl-[1,3]dioxolo[4,5-g]quinolin-8-yl) phosphate |
|---|---|
| PubChem CID | 140617165 |
| Molecular Formula | C28H22NO6PSe |
| Molecular Weight | 578.42 g/mol |
| Exact Mass | 579.03 |
| IUPAC Name | dibenzyl (6-selenophen-2-yl-[1,3]dioxolo[4,5-g]quinolin-8-yl) phosphate |
| SMILES | O=P(OCc1ccccc1)(OCc1ccccc1)Oc1cc(-c2ccc[se]2)nc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C28H22NO6PSe/c30-36(33-17-20-8-3-1-4-9-20,34-18-21-10-5-2-6-11-21)35-25-16-24(28-12-7-13-37-28)29-23-15-27-26(14-22(23)25)31-19-32-27/h1-16H,17-19H2 |
| InChIKey | MFOQZABAFNQKEA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.42 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|