C11H11F2O10S- — CID 140639447
2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-1,1-difluoro-2-oxoethanesulfonate (PubChem CID 140639447) has the molecular formula C11H11F2O10S- and a molecular weight of 373.26 g/mol. Its IUPAC name is 2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-1,1-difluoro-2-oxoethanesulfonate.
| Compound Name | 2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-1,1-difluoro-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 140639447 |
| Molecular Formula | C11H11F2O10S- |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 2-[(4,4-dimethyl-10-oxo-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-9-yl)oxy]-1,1-difluoro-2-oxoethanesulfonate |
| SMILES | CC1(C)OC2OC3C(OC(=O)C(F)(F)S(=O)(=O)[O-])C(=O)OC3C2O1 |
| InChI | InChI=1S/C11H12F2O10S/c1-10(2)22-6-4-3(20-8(6)23-10)5(7(14)19-4)21-9(15)11(12,13)24(16,17)18/h3-6,8H,1-2H3,(H,16,17,18)/p-1 |
| InChIKey | NYMQPRQQWUYSFZ-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 137.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|