C14H16F2O10S — CID 58021682
(10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate (PubChem CID 58021682) has the molecular formula C14H16F2O10S and a molecular weight of 414.34 g/mol. Its IUPAC name is (10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate.
| Compound Name | (10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
|---|---|
| PubChem CID | 58021682 |
| Molecular Formula | C14H16F2O10S |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | (10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,1'-cyclohexane]-9-yl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
| SMILES | O=C1OC2C3OC4(CCCCC4)OC3OC2C1OC(=O)C(F)(F)SOOO |
| InChI | InChI=1S/C14H16F2O10S/c15-14(16,27-26-25-19)12(18)22-8-6-7(20-10(8)17)9-11(21-6)24-13(23-9)4-2-1-3-5-13/h6-9,11,19H,1-5H2 |
| InChIKey | GYADJFDKRVKSQZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|