C16H14Cl2N2NiO2 — CID 140654299
dichloronickel;2-N,3-N-diphenyl-1,4-dioxane-2,3-diimine (PubChem CID 140654299) has the molecular formula C16H14Cl2N2NiO2 and a molecular weight of 395.90 g/mol. Its IUPAC name is dichloronickel;2-N,3-N-diphenyl-1,4-dioxane-2,3-diimine.
| Compound Name | dichloronickel;2-N,3-N-diphenyl-1,4-dioxane-2,3-diimine |
|---|---|
| PubChem CID | 140654299 |
| Molecular Formula | C16H14Cl2N2NiO2 |
| Molecular Weight | 395.90 g/mol |
| Exact Mass | 393.98 |
| IUPAC Name | dichloronickel;2-N,3-N-diphenyl-1,4-dioxane-2,3-diimine |
| SMILES | Cl[Ni]Cl.c1ccc(/N=C2\OCCO\C2=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C16H14N2O2.2ClH.Ni/c1-3-7-13(8-4-1)17-15-16(20-12-11-19-15)18-14-9-5-2-6-10-14;;;/h1-10H,11-12H2;2*1H;/q;;;+2/p-2/b17-15-,18-16-;;; |
| InChIKey | HHCLZBMCFOVNGX-SBOHBPTJSA-L |
| XLogP | 4.87 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.90 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|