C37H44I2N2O8S2 — CID 140655693
2-[(1E,3E,5E,7Z)-7-[3-(5-carboxypentyl)-4,6-diiodo-1,3-dimethylindol-2-ylidene]hepta-1,3,5-trienyl]-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-5-sulfonate (PubChem CID 140655693) has the molecular formula C37H44I2N2O8S2 and a molecular weight of 962.71 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7Z)-7-[3-(5-carboxypentyl)-4,6-diiodo-1,3-dimethylindol-2-ylidene]hepta-1,3,5-trienyl]-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-5-sulfonate.
| Compound Name | 2-[(1E,3E,5E,7Z)-7-[3-(5-carboxypentyl)-4,6-diiodo-1,3-dimethylindol-2-ylidene]hepta-1,3,5-trienyl]-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-5-sulfonate |
|---|---|
| PubChem CID | 140655693 |
| Molecular Formula | C37H44I2N2O8S2 |
| Molecular Weight | 962.71 g/mol |
| Exact Mass | 962.06 |
| IUPAC Name | 2-[(1E,3E,5E,7Z)-7-[3-(5-carboxypentyl)-4,6-diiodo-1,3-dimethylindol-2-ylidene]hepta-1,3,5-trienyl]-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-5-sulfonate |
| SMILES | CN1/C(=C\C=C\C=C\C=C\C2=[N+](CCCCS(=O)(=O)O)c3ccc(S(=O)(=O)[O-])cc3C2(C)C)C(C)(CCCCCC(=O)O)c2c(I)cc(I)cc21 |
| InChI | InChI=1S/C37H44I2N2O8S2/c1-36(2)28-25-27(51(47,48)49)18-19-30(28)41(21-13-14-22-50(44,45)46)32(36)15-9-6-5-7-10-16-33-37(3,20-12-8-11-17-34(42)43)35-29(39)23-26(38)24-31(35)40(33)4/h5-7,9-10,15-16,18-19,23-25H,8,11-14,17,20-22H2,1-4H3,(H2-,42,43,44,45,46,47,48,49) |
| InChIKey | UXAZXNIIYUZQQG-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.71 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|