C37H45I2N2O8S2+ — CID 123578653
6-[2-[7-[3,3-dimethyl-5-sulfo-1-(1-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-4,6-diiodo-1,3-dimethylindol-3-yl]hexanoic acid (PubChem CID 123578653) has the molecular formula C37H45I2N2O8S2+ and a molecular weight of 963.71 g/mol. Its IUPAC name is 6-[2-[7-[3,3-dimethyl-5-sulfo-1-(1-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-4,6-diiodo-1,3-dimethylindol-3-yl]hexanoic acid.
| Compound Name | 6-[2-[7-[3,3-dimethyl-5-sulfo-1-(1-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-4,6-diiodo-1,3-dimethylindol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 123578653 |
| Molecular Formula | C37H45I2N2O8S2+ |
| Molecular Weight | 963.71 g/mol |
| Exact Mass | 963.07 |
| IUPAC Name | 6-[2-[7-[3,3-dimethyl-5-sulfo-1-(1-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-4,6-diiodo-1,3-dimethylindol-3-yl]hexanoic acid |
| SMILES | CCCC([N+]1=C(C=CC=CC=CC=C2N(C)c3cc(I)cc(I)c3C2(C)CCCCCC(=O)O)C(C)(C)c2cc(S(=O)(=O)O)ccc21)S(=O)(=O)O |
| InChI | InChI=1S/C37H44I2N2O8S2/c1-6-15-33(51(47,48)49)41-29-20-19-26(50(44,45)46)24-27(29)36(2,3)31(41)16-11-8-7-9-12-17-32-37(4,21-14-10-13-18-34(42)43)35-28(39)22-25(38)23-30(35)40(32)5/h7-9,11-12,16-17,19-20,22-24,33H,6,10,13-15,18,21H2,1-5H3,(H2-,42,43,44,45,46,47,48,49)/p+1 |
| InChIKey | RTHRRBGETBFQOZ-UHFFFAOYSA-O |
| XLogP | 8.53 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.71 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|