C36H43I2N2O8S2+ — CID 123391789
5-[2-[7-[3,3-dimethyl-5-sulfo-1-(1-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-4,6-diiodo-1,3-dimethylindol-3-yl]pentanoic acid (PubChem CID 123391789) has the molecular formula C36H43I2N2O8S2+ and a molecular weight of 949.69 g/mol. Its IUPAC name is 5-[2-[7-[3,3-dimethyl-5-sulfo-1-(1-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-4,6-diiodo-1,3-dimethylindol-3-yl]pentanoic acid.
| Compound Name | 5-[2-[7-[3,3-dimethyl-5-sulfo-1-(1-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-4,6-diiodo-1,3-dimethylindol-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 123391789 |
| Molecular Formula | C36H43I2N2O8S2+ |
| Molecular Weight | 949.69 g/mol |
| Exact Mass | 949.05 |
| IUPAC Name | 5-[2-[7-[3,3-dimethyl-5-sulfo-1-(1-sulfobutyl)indol-1-ium-2-yl]hepta-2,4,6-trienylidene]-4,6-diiodo-1,3-dimethylindol-3-yl]pentanoic acid |
| SMILES | CCCC([N+]1=C(C=CC=CC=CC=C2N(C)c3cc(I)cc(I)c3C2(C)CCCCC(=O)O)C(C)(C)c2cc(S(=O)(=O)O)ccc21)S(=O)(=O)O |
| InChI | InChI=1S/C36H42I2N2O8S2/c1-6-14-32(50(46,47)48)40-28-19-18-25(49(43,44)45)23-26(28)35(2,3)30(40)15-10-8-7-9-11-16-31-36(4,20-13-12-17-33(41)42)34-27(38)21-24(37)22-29(34)39(31)5/h7-11,15-16,18-19,21-23,32H,6,12-14,17,20H2,1-5H3,(H2-,41,42,43,44,45,46,47,48)/p+1 |
| InChIKey | JMRRYQGZNUQSOK-UHFFFAOYSA-O |
| XLogP | 8.14 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.69 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|