C16H23N5O — CID 140656132
4-[(2-cyclohexyl-7H-purin-6-yl)amino]-2-methylbut-2-en-1-ol (PubChem CID 140656132) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-[(2-cyclohexyl-7H-purin-6-yl)amino]-2-methylbut-2-en-1-ol.
| Compound Name | 4-[(2-cyclohexyl-7H-purin-6-yl)amino]-2-methylbut-2-en-1-ol |
|---|---|
| PubChem CID | 140656132 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 4-[(2-cyclohexyl-7H-purin-6-yl)amino]-2-methylbut-2-en-1-ol |
| SMILES | CC(=CCNc1nc(C2CCCCC2)nc2nc[nH]c12)CO |
| InChI | InChI=1S/C16H23N5O/c1-11(9-22)7-8-17-15-13-16(19-10-18-13)21-14(20-15)12-5-3-2-4-6-12/h7,10,12,22H,2-6,8-9H2,1H3,(H2,17,18,19,20,21) |
| InChIKey | TXYWCNOIDWEKHD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|