C20H33ClF3N5O2 — CID 140675357
4-chloro-N-[N'-(2-ethoxyethyl)-N-[6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]carbamimidoyl]cyclohexane-1-carboxamide (PubChem CID 140675357) has the molecular formula C20H33ClF3N5O2 and a molecular weight of 467.96 g/mol. Its IUPAC name is 4-chloro-N-[N'-(2-ethoxyethyl)-N-[6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]carbamimidoyl]cyclohexane-1-carboxamide.
| Compound Name | 4-chloro-N-[N'-(2-ethoxyethyl)-N-[6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]carbamimidoyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140675357 |
| Molecular Formula | C20H33ClF3N5O2 |
| Molecular Weight | 467.96 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 4-chloro-N-[N'-(2-ethoxyethyl)-N-[6-(trifluoromethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-yl]carbamimidoyl]cyclohexane-1-carboxamide |
| SMILES | CCOCC/N=C(\NC(=O)C1CCC(Cl)CC1)NC1NNC2CC(C(F)(F)F)CCC21 |
| InChI | InChI=1S/C20H33ClF3N5O2/c1-2-31-10-9-25-19(27-18(30)12-3-6-14(21)7-4-12)26-17-15-8-5-13(20(22,23)24)11-16(15)28-29-17/h12-17,28-29H,2-11H2,1H3,(H2,25,26,27,30) |
| InChIKey | MLBLTJLXZPYLKL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.96 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|