C5H10N4O3 — CID 140677657
(Z)-2-amino-4-(diaminomethylideneamino)oxybut-2-enoic acid (PubChem CID 140677657) has the molecular formula C5H10N4O3 and a molecular weight of 174.16 g/mol. Its IUPAC name is (Z)-2-amino-4-(diaminomethylideneamino)oxybut-2-enoic acid.
| Compound Name | (Z)-2-amino-4-(diaminomethylideneamino)oxybut-2-enoic acid |
|---|---|
| PubChem CID | 140677657 |
| Molecular Formula | C5H10N4O3 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (Z)-2-amino-4-(diaminomethylideneamino)oxybut-2-enoic acid |
| SMILES | NC(N)=NOC/C=C(\N)C(=O)O |
| InChI | InChI=1S/C5H10N4O3/c6-3(4(10)11)1-2-12-9-5(7)8/h1H,2,6H2,(H,10,11)(H4,7,8,9)/b3-1- |
| InChIKey | KNOVMQUSJQEMMS-IWQZZHSRSA-N |
| XLogP | -1.88 |
| TPSA | 136.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|