C28H35ClN6O2 — CID 140679988
N-[1-[1-[4-(tert-butylamino)but-2-enoyl]azepan-3-yl]-7-chlorobenzimidazol-2-yl]-2-methylpyridine-4-carboxamide (PubChem CID 140679988) has the molecular formula C28H35ClN6O2 and a molecular weight of 523.08 g/mol. Its IUPAC name is N-[1-[1-[4-(tert-butylamino)but-2-enoyl]azepan-3-yl]-7-chlorobenzimidazol-2-yl]-2-methylpyridine-4-carboxamide.
| Compound Name | N-[1-[1-[4-(tert-butylamino)but-2-enoyl]azepan-3-yl]-7-chlorobenzimidazol-2-yl]-2-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 140679988 |
| Molecular Formula | C28H35ClN6O2 |
| Molecular Weight | 523.08 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | N-[1-[1-[4-(tert-butylamino)but-2-enoyl]azepan-3-yl]-7-chlorobenzimidazol-2-yl]-2-methylpyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nc3cccc(Cl)c3n2C2CCCCN(C(=O)C=CCNC(C)(C)C)C2)ccn1 |
| InChI | InChI=1S/C28H35ClN6O2/c1-19-17-20(13-15-30-19)26(37)33-27-32-23-11-7-10-22(29)25(23)35(27)21-9-5-6-16-34(18-21)24(36)12-8-14-31-28(2,3)4/h7-8,10-13,15,17,21,31H,5-6,9,14,16,18H2,1-4H3,(H,32,33,37) |
| InChIKey | FNGWXUSKVKNLMN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.08 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|