C26H30Cl2N6O2 — CID 154175150
5,6-dichloro-N-[1-[1-[4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]pyridine-3-carboxamide (PubChem CID 154175150) has the molecular formula C26H30Cl2N6O2 and a molecular weight of 529.47 g/mol. Its IUPAC name is 5,6-dichloro-N-[1-[1-[4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[1-[1-[4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 154175150 |
| Molecular Formula | C26H30Cl2N6O2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | 5,6-dichloro-N-[1-[1-[4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]pyridine-3-carboxamide |
| SMILES | Cc1cccc2nc(NC(=O)c3cnc(Cl)c(Cl)c3)n(C3CCCCN(C(=O)C=CCN(C)C)C3)c12 |
| InChI | InChI=1S/C26H30Cl2N6O2/c1-17-8-6-10-21-23(17)34(26(30-21)31-25(36)18-14-20(27)24(28)29-15-18)19-9-4-5-13-33(16-19)22(35)11-7-12-32(2)3/h6-8,10-11,14-15,19H,4-5,9,12-13,16H2,1-3H3,(H,30,31,36) |
| InChIKey | GRZNRRRHXHPCCN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|