C27H30ClF3N6O3 — CID 118223861
2-chloro-N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-(trifluoromethoxy)pyridine-4-carboxamide (PubChem CID 118223861) has the molecular formula C27H30ClF3N6O3 and a molecular weight of 579.02 g/mol. Its IUPAC name is 2-chloro-N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-(trifluoromethoxy)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-(trifluoromethoxy)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 118223861 |
| Molecular Formula | C27H30ClF3N6O3 |
| Molecular Weight | 579.02 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | 2-chloro-N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-(trifluoromethoxy)pyridine-4-carboxamide |
| SMILES | Cc1cccc2nc(NC(=O)c3cc(Cl)nc(OC(F)(F)F)c3)n([C@@H]3CCCCN(C(=O)/C=C/CN(C)C)C3)c12 |
| InChI | InChI=1S/C27H30ClF3N6O3/c1-17-8-6-10-20-24(17)37(19-9-4-5-13-36(16-19)23(38)11-7-12-35(2)3)26(32-20)34-25(39)18-14-21(28)33-22(15-18)40-27(29,30)31/h6-8,10-11,14-15,19H,4-5,9,12-13,16H2,1-3H3,(H,32,34,39)/b11-7+/t19-/m1/s1 |
| InChIKey | CKSOJBKTVCPVPI-BQHJZSHBSA-N |
| XLogP | 5.22 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.02 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|