C27H33ClN6O2 — CID 72703988
N-[7-chloro-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2,6-dimethylpyridine-4-carboxamide (PubChem CID 72703988) has the molecular formula C27H33ClN6O2 and a molecular weight of 509.05 g/mol. Its IUPAC name is N-[7-chloro-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2,6-dimethylpyridine-4-carboxamide.
| Compound Name | N-[7-chloro-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2,6-dimethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 72703988 |
| Molecular Formula | C27H33ClN6O2 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | N-[7-chloro-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2,6-dimethylpyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nc3cccc(Cl)c3n2C2CCCCN(C(=O)/C=C/CN(C)C)C2)cc(C)n1 |
| InChI | InChI=1S/C27H33ClN6O2/c1-18-15-20(16-19(2)29-18)26(36)31-27-30-23-11-7-10-22(28)25(23)34(27)21-9-5-6-14-33(17-21)24(35)12-8-13-32(3)4/h7-8,10-12,15-16,21H,5-6,9,13-14,17H2,1-4H3,(H,30,31,36)/b12-8+ |
| InChIKey | UQLIJVPLMFPORY-XYOKQWHBSA-N |
| XLogP | 4.63 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|