C24H28ClN7O2 — CID 118224061
N-[7-chloro-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]pyridazine-4-carboxamide (PubChem CID 118224061) has the molecular formula C24H28ClN7O2 and a molecular weight of 481.99 g/mol. Its IUPAC name is N-[7-chloro-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]pyridazine-4-carboxamide.
| Compound Name | N-[7-chloro-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 118224061 |
| Molecular Formula | C24H28ClN7O2 |
| Molecular Weight | 481.99 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-[7-chloro-1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]pyridazine-4-carboxamide |
| SMILES | CN(C)C/C=C/C(=O)N1CCCCC(n2c(NC(=O)c3ccnnc3)nc3cccc(Cl)c32)C1 |
| InChI | InChI=1S/C24H28ClN7O2/c1-30(2)13-6-10-21(33)31-14-4-3-7-18(16-31)32-22-19(25)8-5-9-20(22)28-24(32)29-23(34)17-11-12-26-27-15-17/h5-6,8-12,15,18H,3-4,7,13-14,16H2,1-2H3,(H,28,29,34)/b10-6+ |
| InChIKey | OUTZPQYRZCOSPM-UXBLZVDNSA-N |
| XLogP | 3.40 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.99 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|