C26H33N7O2 — CID 118224030
N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-methylpyridazine-4-carboxamide (PubChem CID 118224030) has the molecular formula C26H33N7O2 and a molecular weight of 475.60 g/mol. Its IUPAC name is N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-methylpyridazine-4-carboxamide.
| Compound Name | N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-methylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 118224030 |
| Molecular Formula | C26H33N7O2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-methylpyridazine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nc3cccc(C)c3n2[C@@H]2CCCCN(C(=O)/C=C/CN(C)C)C2)cnn1 |
| InChI | InChI=1S/C26H33N7O2/c1-18-9-7-11-22-24(18)33(26(28-22)29-25(35)20-15-19(2)30-27-16-20)21-10-5-6-14-32(17-21)23(34)12-8-13-31(3)4/h7-9,11-12,15-16,21H,5-6,10,13-14,17H2,1-4H3,(H,28,29,35)/b12-8+/t21-/m1/s1 |
| InChIKey | CVQCRGYFEVUAFL-NBILRRPASA-N |
| XLogP | 3.37 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|