C27H33ClN6O3 — CID 118223624
2-chloro-N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-methoxypyridine-4-carboxamide (PubChem CID 118223624) has the molecular formula C27H33ClN6O3 and a molecular weight of 525.05 g/mol. Its IUPAC name is 2-chloro-N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-methoxypyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 118223624 |
| Molecular Formula | C27H33ClN6O3 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | 2-chloro-N-[1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]-6-methoxypyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)Nc2nc3cccc(C)c3n2[C@@H]2CCCCN(C(=O)/C=C/CN(C)C)C2)cc(Cl)n1 |
| InChI | InChI=1S/C27H33ClN6O3/c1-18-9-7-11-21-25(18)34(20-10-5-6-14-33(17-20)24(35)12-8-13-32(2)3)27(29-21)31-26(36)19-15-22(28)30-23(16-19)37-4/h7-9,11-12,15-16,20H,5-6,10,13-14,17H2,1-4H3,(H,29,31,36)/b12-8+/t20-/m1/s1 |
| InChIKey | PWIYPRPUGZDXNO-GPVYEGESSA-N |
| XLogP | 4.33 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|