C28H36ClN6O3P — CID 123403076
N-[7-chloro-1-[1-[4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2-dimethylphosphoryl-6-methylpyridine-4-carboxamide (PubChem CID 123403076) has the molecular formula C28H36ClN6O3P and a molecular weight of 571.06 g/mol. Its IUPAC name is N-[7-chloro-1-[1-[4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2-dimethylphosphoryl-6-methylpyridine-4-carboxamide.
| Compound Name | N-[7-chloro-1-[1-[4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2-dimethylphosphoryl-6-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 123403076 |
| Molecular Formula | C28H36ClN6O3P |
| Molecular Weight | 571.06 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | N-[7-chloro-1-[1-[4-(dimethylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2-dimethylphosphoryl-6-methylpyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nc3cccc(Cl)c3n2C2CCCCN(C(=O)C=CCN(C)C)C2)cc(P(C)(C)=O)n1 |
| InChI | InChI=1S/C28H36ClN6O3P/c1-19-16-20(17-24(30-19)39(4,5)38)27(37)32-28-31-23-12-8-11-22(29)26(23)35(28)21-10-6-7-15-34(18-21)25(36)13-9-14-33(2)3/h8-9,11-13,16-17,21H,6-7,10,14-15,18H2,1-5H3,(H,31,32,37) |
| InChIKey | RWFZOCMKERWXEI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.06 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|