C26H31ClN6O2 — CID 123726005
N-[7-chloro-1-[1-[4-(methylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2,6-dimethylpyridine-4-carboxamide (PubChem CID 123726005) has the molecular formula C26H31ClN6O2 and a molecular weight of 495.03 g/mol. Its IUPAC name is N-[7-chloro-1-[1-[4-(methylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2,6-dimethylpyridine-4-carboxamide.
| Compound Name | N-[7-chloro-1-[1-[4-(methylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2,6-dimethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 123726005 |
| Molecular Formula | C26H31ClN6O2 |
| Molecular Weight | 495.03 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N-[7-chloro-1-[1-[4-(methylamino)but-2-enoyl]azepan-3-yl]benzimidazol-2-yl]-2,6-dimethylpyridine-4-carboxamide |
| SMILES | CNCC=CC(=O)N1CCCCC(n2c(NC(=O)c3cc(C)nc(C)c3)nc3cccc(Cl)c32)C1 |
| InChI | InChI=1S/C26H31ClN6O2/c1-17-14-19(15-18(2)29-17)25(35)31-26-30-22-10-6-9-21(27)24(22)33(26)20-8-4-5-13-32(16-20)23(34)11-7-12-28-3/h6-7,9-11,14-15,20,28H,4-5,8,12-13,16H2,1-3H3,(H,30,31,35) |
| InChIKey | MHPJPOLMCIELFS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.03 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|