C25H31N7O2 — CID 118223916
N-[1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]pyridazine-3-carboxamide (PubChem CID 118223916) has the molecular formula C25H31N7O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]pyridazine-3-carboxamide.
| Compound Name | N-[1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 118223916 |
| Molecular Formula | C25H31N7O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | N-[1-[1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-7-methylbenzimidazol-2-yl]pyridazine-3-carboxamide |
| SMILES | Cc1cccc2nc(NC(=O)c3cccnn3)n(C3CCCCN(C(=O)/C=C/CN(C)C)C3)c12 |
| InChI | InChI=1S/C25H31N7O2/c1-18-9-6-11-20-23(18)32(25(27-20)28-24(34)21-12-7-14-26-29-21)19-10-4-5-16-31(17-19)22(33)13-8-15-30(2)3/h6-9,11-14,19H,4-5,10,15-17H2,1-3H3,(H,27,28,34)/b13-8+ |
| InChIKey | WAOKHJBWRKYTQU-MDWZMJQESA-N |
| XLogP | 3.06 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|