C25H30ClN7O2 — CID 118228921
N-[7-chloro-1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-6-methylbenzimidazol-2-yl]pyridazine-4-carboxamide (PubChem CID 118228921) has the molecular formula C25H30ClN7O2 and a molecular weight of 496.02 g/mol. Its IUPAC name is N-[7-chloro-1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-6-methylbenzimidazol-2-yl]pyridazine-4-carboxamide.
| Compound Name | N-[7-chloro-1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-6-methylbenzimidazol-2-yl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 118228921 |
| Molecular Formula | C25H30ClN7O2 |
| Molecular Weight | 496.02 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | N-[7-chloro-1-[(3R)-1-[(E)-4-(dimethylamino)but-2-enoyl]azepan-3-yl]-6-methylbenzimidazol-2-yl]pyridazine-4-carboxamide |
| SMILES | Cc1ccc2nc(NC(=O)c3ccnnc3)n([C@@H]3CCCCN(C(=O)/C=C/CN(C)C)C3)c2c1Cl |
| InChI | InChI=1S/C25H30ClN7O2/c1-17-9-10-20-23(22(17)26)33(25(29-20)30-24(35)18-11-12-27-28-15-18)19-7-4-5-14-32(16-19)21(34)8-6-13-31(2)3/h6,8-12,15,19H,4-5,7,13-14,16H2,1-3H3,(H,29,30,35)/b8-6+/t19-/m1/s1 |
| InChIKey | IHHDYKLXWKFSGQ-ZLQZBKBYSA-N |
| XLogP | 3.71 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.02 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|