C23H17N3O — CID 14068559
2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-phenylethanone (PubChem CID 14068559) has the molecular formula C23H17N3O and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-phenylethanone.
| Compound Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 14068559 |
| Molecular Formula | C23H17N3O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 2-(4,6-diphenyl-1,3,5-triazin-2-yl)-1-phenylethanone |
| SMILES | O=C(Cc1nc(-c2ccccc2)nc(-c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C23H17N3O/c27-20(17-10-4-1-5-11-17)16-21-24-22(18-12-6-2-7-13-18)26-23(25-21)19-14-8-3-9-15-19/h1-15H,16H2 |
| InChIKey | WASYTSCYRGPOIQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |