C32H51Cl3CrN2OP+ — CID 140722990
[[N-(2-tert-butyl-6-methylphenyl)-C-(4-tert-butylphenyl)carbonimidoyl]amino]-di(propan-2-yl)phosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+) (PubChem CID 140722990) has the molecular formula C32H51Cl3CrN2OP+ and a molecular weight of 669.10 g/mol. Its IUPAC name is [[N-(2-tert-butyl-6-methylphenyl)-C-(4-tert-butylphenyl)carbonimidoyl]amino]-di(propan-2-yl)phosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+).
| Compound Name | [[N-(2-tert-butyl-6-methylphenyl)-C-(4-tert-butylphenyl)carbonimidoyl]amino]-di(propan-2-yl)phosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+) |
|---|---|
| PubChem CID | 140722990 |
| Molecular Formula | C32H51Cl3CrN2OP+ |
| Molecular Weight | 669.10 g/mol |
| Exact Mass | 667.22 |
| IUPAC Name | [[N-(2-tert-butyl-6-methylphenyl)-C-(4-tert-butylphenyl)carbonimidoyl]amino]-di(propan-2-yl)phosphanium;2,3,4,5-tetrahydrofuran-5-ide;trichlorochromium(1+) |
| SMILES | Cc1cccc(C(C)(C)C)c1/N=C(/N[PH+](C(C)C)C(C)C)c1ccc(C(C)(C)C)cc1.Cl[Cr+](Cl)Cl.[CH-]1CCCO1 |
| InChI | InChI=1S/C28H43N2P.C4H7O.3ClH.Cr/c1-19(2)31(20(3)4)30-26(22-15-17-23(18-16-22)27(6,7)8)29-25-21(5)13-12-14-24(25)28(9,10)11;1-2-4-5-3-1;;;;/h12-20H,1-11H3,(H,29,30);3H,1-2,4H2;3*1H;/q;-1;;;;+4/p-2 |
| InChIKey | WXHCYWIHVQBEJM-UHFFFAOYSA-L |
| XLogP | 11.23 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.10 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|