C23H17N4+ — CID 140737488
1,3,5-triphenylimidazo[4,5-b]pyrazin-1-ium (PubChem CID 140737488) has the molecular formula C23H17N4+ and a molecular weight of 349.42 g/mol. Its IUPAC name is 1,3,5-triphenylimidazo[4,5-b]pyrazin-1-ium.
| Compound Name | 1,3,5-triphenylimidazo[4,5-b]pyrazin-1-ium |
|---|---|
| PubChem CID | 140737488 |
| Molecular Formula | C23H17N4+ |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 1,3,5-triphenylimidazo[4,5-b]pyrazin-1-ium |
| SMILES | c1ccc(-c2cnc3c(n2)n(-c2ccccc2)c[n+]3-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17N4/c1-4-10-18(11-5-1)21-16-24-22-23(25-21)27(20-14-8-3-9-15-20)17-26(22)19-12-6-2-7-13-19/h1-17H/q+1 |
| InChIKey | VIYLATLBJMMWMM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|