C14H16BFO4 — CID 140761898
cyclohexyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate (PubChem CID 140761898) has the molecular formula C14H16BFO4 and a molecular weight of 278.09 g/mol. Its IUPAC name is cyclohexyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate.
| Compound Name | cyclohexyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate |
|---|---|
| PubChem CID | 140761898 |
| Molecular Formula | C14H16BFO4 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | cyclohexyl 5-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carboxylate |
| SMILES | O=C(OC1CCCCC1)c1cc2c(cc1F)COB2O |
| InChI | InChI=1S/C14H16BFO4/c16-13-6-9-8-19-15(18)12(9)7-11(13)14(17)20-10-4-2-1-3-5-10/h6-7,10,18H,1-5,8H2 |
| InChIKey | PGHVVOSXQHYLQR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|