C12H11BFNO4S — CID 140761934
5-fluoro-1-hydroxy-N-(2-oxothiolan-3-yl)-3H-2,1-benzoxaborole-6-carboxamide (PubChem CID 140761934) has the molecular formula C12H11BFNO4S and a molecular weight of 295.10 g/mol. Its IUPAC name is 5-fluoro-1-hydroxy-N-(2-oxothiolan-3-yl)-3H-2,1-benzoxaborole-6-carboxamide.
| Compound Name | 5-fluoro-1-hydroxy-N-(2-oxothiolan-3-yl)-3H-2,1-benzoxaborole-6-carboxamide |
|---|---|
| PubChem CID | 140761934 |
| Molecular Formula | C12H11BFNO4S |
| Molecular Weight | 295.10 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 5-fluoro-1-hydroxy-N-(2-oxothiolan-3-yl)-3H-2,1-benzoxaborole-6-carboxamide |
| SMILES | O=C(NC1CCSC1=O)c1cc2c(cc1F)COB2O |
| InChI | InChI=1S/C12H11BFNO4S/c14-9-3-6-5-19-13(18)8(6)4-7(9)11(16)15-10-1-2-20-12(10)17/h3-4,10,18H,1-2,5H2,(H,15,16) |
| InChIKey | QVLWFYCVWCPWSR-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.10 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|