C26H41BrClN3O4Si — CID 140772047
tert-butyl 2-[4-[5-bromo-6-chloro-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxycyclohexyl]-2-methylpropanoate (PubChem CID 140772047) has the molecular formula C26H41BrClN3O4Si and a molecular weight of 603.07 g/mol. Its IUPAC name is tert-butyl 2-[4-[5-bromo-6-chloro-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxycyclohexyl]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[4-[5-bromo-6-chloro-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxycyclohexyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 140772047 |
| Molecular Formula | C26H41BrClN3O4Si |
| Molecular Weight | 603.07 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | tert-butyl 2-[4-[5-bromo-6-chloro-3-(2-trimethylsilylethoxymethyl)imidazo[4,5-b]pyridin-2-yl]oxycyclohexyl]-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)C(C)(C)C1CCC(Oc2nc3cc(Cl)c(Br)nc3n2COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C26H41BrClN3O4Si/c1-25(2,3)35-23(32)26(4,5)17-9-11-18(12-10-17)34-24-29-20-15-19(28)21(27)30-22(20)31(24)16-33-13-14-36(6,7)8/h15,17-18H,9-14,16H2,1-8H3 |
| InChIKey | MLSPRDWOAKFFMQ-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.07 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|