C37H62N4O8+2 — CID 140789795
(6-hydroxyhexanoylamino)-[2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-[(6-hydroxyhexanoylamino)-dimethylazaniumyl]propoxy]phenyl]propan-2-yl]phenoxy]propyl]-dimethylazanium (PubChem CID 140789795) has the molecular formula C37H62N4O8+2 and a molecular weight of 690.92 g/mol. Its IUPAC name is (6-hydroxyhexanoylamino)-[2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-[(6-hydroxyhexanoylamino)-dimethylazaniumyl]propoxy]phenyl]propan-2-yl]phenoxy]propyl]-dimethylazanium.
| Compound Name | (6-hydroxyhexanoylamino)-[2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-[(6-hydroxyhexanoylamino)-dimethylazaniumyl]propoxy]phenyl]propan-2-yl]phenoxy]propyl]-dimethylazanium |
|---|---|
| PubChem CID | 140789795 |
| Molecular Formula | C37H62N4O8+2 |
| Molecular Weight | 690.92 g/mol |
| Exact Mass | 690.46 |
| IUPAC Name | (6-hydroxyhexanoylamino)-[2-hydroxy-3-[4-[2-[4-[2-hydroxy-3-[(6-hydroxyhexanoylamino)-dimethylazaniumyl]propoxy]phenyl]propan-2-yl]phenoxy]propyl]-dimethylazanium |
| SMILES | CC(C)(c1ccc(OCC(O)C[N+](C)(C)NC(=O)CCCCCO)cc1)c1ccc(OCC(O)C[N+](C)(C)NC(=O)CCCCCO)cc1 |
| InChI | InChI=1S/C37H60N4O8/c1-37(2,29-15-19-33(20-16-29)48-27-31(44)25-40(3,4)38-35(46)13-9-7-11-23-42)30-17-21-34(22-18-30)49-28-32(45)26-41(5,6)39-36(47)14-10-8-12-24-43/h15-22,31-32,42-45H,7-14,23-28H2,1-6H3/p+2 |
| InChIKey | VAWPXEHUNACLAA-UHFFFAOYSA-P |
| XLogP | 2.81 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.92 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|