C16H42N2O6Si3 — CID 140798011
2-[3-[[[3-(dihydroxyamino)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl-(2-hydroxyethyl)amino]ethanol (PubChem CID 140798011) has the molecular formula C16H42N2O6Si3 and a molecular weight of 442.78 g/mol. Its IUPAC name is 2-[3-[[[3-(dihydroxyamino)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl-(2-hydroxyethyl)amino]ethanol.
| Compound Name | 2-[3-[[[3-(dihydroxyamino)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl-(2-hydroxyethyl)amino]ethanol |
|---|---|
| PubChem CID | 140798011 |
| Molecular Formula | C16H42N2O6Si3 |
| Molecular Weight | 442.78 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 2-[3-[[[3-(dihydroxyamino)propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl-(2-hydroxyethyl)amino]ethanol |
| SMILES | C[Si](C)(CCCN(O)O)O[Si](C)(C)O[Si](C)(C)CCCN(CCO)CCO |
| InChI | InChI=1S/C16H42N2O6Si3/c1-25(2,15-7-9-17(11-13-19)12-14-20)23-27(5,6)24-26(3,4)16-8-10-18(21)22/h19-22H,7-16H2,1-6H3 |
| InChIKey | BRQIMFXLRWYTEO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.78 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|