C24H23ClFN7O3S — CID 140808818
N-[5-[[2-[3-[benzenesulfonyl(cyano)amino]propyl-chloroamino]pyrimidin-4-yl]amino]-2-fluorophenyl]-N-methylprop-2-enamide (PubChem CID 140808818) has the molecular formula C24H23ClFN7O3S and a molecular weight of 544.01 g/mol. Its IUPAC name is N-[5-[[2-[3-[benzenesulfonyl(cyano)amino]propyl-chloroamino]pyrimidin-4-yl]amino]-2-fluorophenyl]-N-methylprop-2-enamide.
| Compound Name | N-[5-[[2-[3-[benzenesulfonyl(cyano)amino]propyl-chloroamino]pyrimidin-4-yl]amino]-2-fluorophenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 140808818 |
| Molecular Formula | C24H23ClFN7O3S |
| Molecular Weight | 544.01 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | N-[5-[[2-[3-[benzenesulfonyl(cyano)amino]propyl-chloroamino]pyrimidin-4-yl]amino]-2-fluorophenyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1cc(Nc2ccnc(N(Cl)CCCN(C#N)S(=O)(=O)c3ccccc3)n2)ccc1F |
| InChI | InChI=1S/C24H23ClFN7O3S/c1-3-23(34)31(2)21-16-18(10-11-20(21)26)29-22-12-13-28-24(30-22)33(25)15-7-14-32(17-27)37(35,36)19-8-5-4-6-9-19/h3-6,8-13,16H,1,7,14-15H2,2H3,(H,28,29,30) |
| InChIKey | JSHIBJPYJRWYCS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.01 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|