C29H40BN3O6 — CID 140809099
methyl N-[1-(oxan-4-yl)-2-oxo-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethyl]carbamate (PubChem CID 140809099) has the molecular formula C29H40BN3O6 and a molecular weight of 537.47 g/mol. Its IUPAC name is methyl N-[1-(oxan-4-yl)-2-oxo-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethyl]carbamate.
| Compound Name | methyl N-[1-(oxan-4-yl)-2-oxo-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 140809099 |
| Molecular Formula | C29H40BN3O6 |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | methyl N-[1-(oxan-4-yl)-2-oxo-2-[(2S)-2-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]pyrrolidin-1-yl]ethyl]carbamate |
| SMILES | COC(=O)NC(C(=O)N1CCC[C@H]1C1=NC=C(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C1)C1CCOCC1 |
| InChI | InChI=1S/C29H40BN3O6/c1-28(2)29(3,4)39-30(38-28)22-10-8-19(9-11-22)21-17-23(31-18-21)24-7-6-14-33(24)26(34)25(32-27(35)36-5)20-12-15-37-16-13-20/h8-11,18,20,24-25H,6-7,12-17H2,1-5H3,(H,32,35)/t24-,25?/m0/s1 |
| InChIKey | JNCHDEMUBGFDRX-SKCDSABHSA-N |
| XLogP | 3.31 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|