C28H40BN3O6 — CID 140809113
methyl N-[(2S)-1-[(4R)-2,2-dimethyl-4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-1,3-oxazolidin-3-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 140809113) has the molecular formula C28H40BN3O6 and a molecular weight of 525.46 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(4R)-2,2-dimethyl-4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-1,3-oxazolidin-3-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[(4R)-2,2-dimethyl-4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-1,3-oxazolidin-3-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 140809113 |
| Molecular Formula | C28H40BN3O6 |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | methyl N-[(2S)-1-[(4R)-2,2-dimethyl-4-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3H-pyrrol-2-yl]-1,3-oxazolidin-3-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1[C@H](C2=NC=C(c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)C2)COC1(C)C)C(C)C |
| InChI | InChI=1S/C28H40BN3O6/c1-17(2)23(31-25(34)35-9)24(33)32-22(16-36-28(32,7)8)21-14-19(15-30-21)18-10-12-20(13-11-18)29-37-26(3,4)27(5,6)38-29/h10-13,15,17,22-23H,14,16H2,1-9H3,(H,31,34)/t22-,23-/m0/s1 |
| InChIKey | NONOGHWWXMQHEN-GOTSBHOMSA-N |
| XLogP | 3.52 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|