C12H11BO6 — CID 140830505
4-hydroxy-7-methoxy-1,3-dihydrofuro[3,4-c][1,2]benzoxaborinine-6-carboxylic acid (PubChem CID 140830505) has the molecular formula C12H11BO6 and a molecular weight of 262.03 g/mol. Its IUPAC name is 4-hydroxy-7-methoxy-1,3-dihydrofuro[3,4-c][1,2]benzoxaborinine-6-carboxylic acid.
| Compound Name | 4-hydroxy-7-methoxy-1,3-dihydrofuro[3,4-c][1,2]benzoxaborinine-6-carboxylic acid |
|---|---|
| PubChem CID | 140830505 |
| Molecular Formula | C12H11BO6 |
| Molecular Weight | 262.03 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-hydroxy-7-methoxy-1,3-dihydrofuro[3,4-c][1,2]benzoxaborinine-6-carboxylic acid |
| SMILES | COc1ccc2c(c1C(=O)O)OB(O)C1=C2COC1 |
| InChI | InChI=1S/C12H11BO6/c1-17-9-3-2-6-7-4-18-5-8(7)13(16)19-11(6)10(9)12(14)15/h2-3,16H,4-5H2,1H3,(H,14,15) |
| InChIKey | PXBGIPQPDDGPQL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.03 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|