C30H34 — CID 14085765
2-[2,2,3,3-tetramethyl-1-[2-(2,2,3,3-tetramethyl-1-phenylcyclopropyl)ethynyl]cyclopropyl]ethynylbenzene (PubChem CID 14085765) has the molecular formula C30H34 and a molecular weight of 394.60 g/mol. Its IUPAC name is 2-[2,2,3,3-tetramethyl-1-[2-(2,2,3,3-tetramethyl-1-phenylcyclopropyl)ethynyl]cyclopropyl]ethynylbenzene.
| Compound Name | 2-[2,2,3,3-tetramethyl-1-[2-(2,2,3,3-tetramethyl-1-phenylcyclopropyl)ethynyl]cyclopropyl]ethynylbenzene |
|---|---|
| PubChem CID | 14085765 |
| Molecular Formula | C30H34 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 2-[2,2,3,3-tetramethyl-1-[2-(2,2,3,3-tetramethyl-1-phenylcyclopropyl)ethynyl]cyclopropyl]ethynylbenzene |
| SMILES | CC1(C)C(C)(C)C1(C#Cc1ccccc1)C#CC1(c2ccccc2)C(C)(C)C1(C)C |
| InChI | InChI=1S/C30H34/c1-25(2)26(3,4)29(25,20-19-23-15-11-9-12-16-23)21-22-30(24-17-13-10-14-18-24)27(5,6)28(30,7)8/h9-18H,1-8H3 |
| InChIKey | UDNFSKKSDXPXGQ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|