C12H10Cl2 — CID 14321527
2-(2,2-dichloro-1-methylcyclopropyl)ethynylbenzene (PubChem CID 14321527) has the molecular formula C12H10Cl2 and a molecular weight of 225.12 g/mol. Its IUPAC name is 2-(2,2-dichloro-1-methylcyclopropyl)ethynylbenzene.
| Compound Name | 2-(2,2-dichloro-1-methylcyclopropyl)ethynylbenzene |
|---|---|
| PubChem CID | 14321527 |
| Molecular Formula | C12H10Cl2 |
| Molecular Weight | 225.12 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-(2,2-dichloro-1-methylcyclopropyl)ethynylbenzene |
| SMILES | CC1(C#Cc2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C12H10Cl2/c1-11(9-12(11,13)14)8-7-10-5-3-2-4-6-10/h2-6H,9H2,1H3 |
| InChIKey | POPPMZAJQFWASO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.12 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|