C28H33F4NO2Si — CID 140879066
3-[tert-butyl(diphenyl)silyl]oxy-1-[3-fluoro-4-(trifluoromethoxy)phenyl]-2,2-dimethylpropan-1-amine (PubChem CID 140879066) has the molecular formula C28H33F4NO2Si and a molecular weight of 519.66 g/mol. Its IUPAC name is 3-[tert-butyl(diphenyl)silyl]oxy-1-[3-fluoro-4-(trifluoromethoxy)phenyl]-2,2-dimethylpropan-1-amine.
| Compound Name | 3-[tert-butyl(diphenyl)silyl]oxy-1-[3-fluoro-4-(trifluoromethoxy)phenyl]-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 140879066 |
| Molecular Formula | C28H33F4NO2Si |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 3-[tert-butyl(diphenyl)silyl]oxy-1-[3-fluoro-4-(trifluoromethoxy)phenyl]-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(N)c1ccc(OC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C28H33F4NO2Si/c1-26(2,3)36(21-12-8-6-9-13-21,22-14-10-7-11-15-22)34-19-27(4,5)25(33)20-16-17-24(23(29)18-20)35-28(30,31)32/h6-18,25H,19,33H2,1-5H3 |
| InChIKey | RGFLVOPTHAUMLJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|