C9H18NO7P — CID 140884247
(3R)-4-oxo-3-phosphonooxy-3-[(trimethylazaniumyl)methyl]pentanoate (PubChem CID 140884247) has the molecular formula C9H18NO7P and a molecular weight of 283.22 g/mol. Its IUPAC name is (3R)-4-oxo-3-phosphonooxy-3-[(trimethylazaniumyl)methyl]pentanoate.
| Compound Name | (3R)-4-oxo-3-phosphonooxy-3-[(trimethylazaniumyl)methyl]pentanoate |
|---|---|
| PubChem CID | 140884247 |
| Molecular Formula | C9H18NO7P |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (3R)-4-oxo-3-phosphonooxy-3-[(trimethylazaniumyl)methyl]pentanoate |
| SMILES | CC(=O)[C@@](CC(=O)[O-])(C[N+](C)(C)C)OP(=O)(O)O |
| InChI | InChI=1S/C9H18NO7P/c1-7(11)9(5-8(12)13,6-10(2,3)4)17-18(14,15)16/h5-6H2,1-4H3,(H2-,12,13,14,15,16)/t9-/m1/s1 |
| InChIKey | GYQXOQPWYMONBS-SECBINFHSA-N |
| XLogP | -1.73 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|