C11H6N5O3S- — CID 140885579
1,3,6-triaza-9-azonia-8-azanidatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,9,11(16),12,14-heptaene-13-sulfonate (PubChem CID 140885579) has the molecular formula C11H6N5O3S- and a molecular weight of 288.27 g/mol. Its IUPAC name is 1,3,6-triaza-9-azonia-8-azanidatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,9,11(16),12,14-heptaene-13-sulfonate.
| Compound Name | 1,3,6-triaza-9-azonia-8-azanidatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,9,11(16),12,14-heptaene-13-sulfonate |
|---|---|
| PubChem CID | 140885579 |
| Molecular Formula | C11H6N5O3S- |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 1,3,6-triaza-9-azonia-8-azanidatetracyclo[7.7.0.02,7.011,16]hexadeca-2,4,6,9,11(16),12,14-heptaene-13-sulfonate |
| SMILES | O=S(=O)([O-])c1ccc2c(c1)c[n+]1[n-]c3nccnc3n21 |
| InChI | InChI=1S/C11H7N5O3S/c17-20(18,19)8-1-2-9-7(5-8)6-15-14-10-11(16(9)15)13-4-3-12-10/h1-6H,(H,17,18,19)/p-1 |
| InChIKey | JXVOFDJVKNLKQW-UHFFFAOYSA-M |
| XLogP | -0.52 |
| TPSA | 105.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|