C9H9N3O2 — CID 140977093
2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-diene-5,7-dione (PubChem CID 140977093) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-diene-5,7-dione.
| Compound Name | 2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-diene-5,7-dione |
|---|---|
| PubChem CID | 140977093 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2,6,12-triazatricyclo[6.3.1.04,12]dodeca-1(11),9-diene-5,7-dione |
| SMILES | O=C1NC(=O)C2CNC3=CC=CC1N32 |
| InChI | InChI=1S/C9H9N3O2/c13-8-5-2-1-3-7-10-4-6(12(5)7)9(14)11-8/h1-3,5-6,10H,4H2,(H,11,13,14) |
| InChIKey | BRTHIBFJOUMLGN-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|