C16H26N4O2S — CID 140980197
5-(4,5-diamino-1,6-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-5,6-dimethylcyclohexa-1,3-diene-1,2-diamine (PubChem CID 140980197) has the molecular formula C16H26N4O2S and a molecular weight of 338.48 g/mol. Its IUPAC name is 5-(4,5-diamino-1,6-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-5,6-dimethylcyclohexa-1,3-diene-1,2-diamine.
| Compound Name | 5-(4,5-diamino-1,6-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-5,6-dimethylcyclohexa-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 140980197 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 5-(4,5-diamino-1,6-dimethylcyclohexa-2,4-dien-1-yl)sulfonyl-5,6-dimethylcyclohexa-1,3-diene-1,2-diamine |
| SMILES | CC1C(N)=C(N)C=CC1(C)S(=O)(=O)C1(C)C=CC(N)=C(N)C1C |
| InChI | InChI=1S/C16H26N4O2S/c1-9-13(19)11(17)5-7-15(9,3)23(21,22)16(4)8-6-12(18)14(20)10(16)2/h5-10H,17-20H2,1-4H3 |
| InChIKey | PFSGOHXDLHRHSW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |