C17H20O3 — CID 140983903
2-(2,2-diphenylpropoxy)ethane-1,1-diol (PubChem CID 140983903) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-(2,2-diphenylpropoxy)ethane-1,1-diol.
| Compound Name | 2-(2,2-diphenylpropoxy)ethane-1,1-diol |
|---|---|
| PubChem CID | 140983903 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-(2,2-diphenylpropoxy)ethane-1,1-diol |
| SMILES | CC(COCC(O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20O3/c1-17(13-20-12-16(18)19,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16,18-19H,12-13H2,1H3 |
| InChIKey | LKLKGPCAYVOWNK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|