C9H10O3 — CID 140991101
2-propyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3,4-diol (PubChem CID 140991101) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-propyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3,4-diol.
| Compound Name | 2-propyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3,4-diol |
|---|---|
| PubChem CID | 140991101 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-propyl-7-oxabicyclo[4.1.0]hepta-1(6),2,4-triene-3,4-diol |
| SMILES | CCCc1c(O)c(O)cc2c1O2 |
| InChI | InChI=1S/C9H10O3/c1-2-3-5-8(11)6(10)4-7-9(5)12-7/h4,10-11H,2-3H2,1H3 |
| InChIKey | XVGKGHVNUPOILG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|