C11H14O2 — CID 141021516
4-(oxan-2-yl)cyclohexa-2,4-dien-1-one (PubChem CID 141021516) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-(oxan-2-yl)cyclohexa-2,4-dien-1-one.
| Compound Name | 4-(oxan-2-yl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 141021516 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 4-(oxan-2-yl)cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC(C2CCCCO2)=CC1 |
| InChI | InChI=1S/C11H14O2/c12-10-6-4-9(5-7-10)11-3-1-2-8-13-11/h4-6,11H,1-3,7-8H2 |
| InChIKey | UAYQZLUVULJMKG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |