C10H11N3O6S — CID 141036086
4-[1-(1,3-benzodioxol-5-yl)ethyl]-2,2-dioxo-1,3,2,4,6-dioxathiadiazin-5-amine (PubChem CID 141036086) has the molecular formula C10H11N3O6S and a molecular weight of 301.28 g/mol. Its IUPAC name is 4-[1-(1,3-benzodioxol-5-yl)ethyl]-2,2-dioxo-1,3,2,4,6-dioxathiadiazin-5-amine.
| Compound Name | 4-[1-(1,3-benzodioxol-5-yl)ethyl]-2,2-dioxo-1,3,2,4,6-dioxathiadiazin-5-amine |
|---|---|
| PubChem CID | 141036086 |
| Molecular Formula | C10H11N3O6S |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 4-[1-(1,3-benzodioxol-5-yl)ethyl]-2,2-dioxo-1,3,2,4,6-dioxathiadiazin-5-amine |
| SMILES | CC(c1ccc2c(c1)OCO2)N1OS(=O)(=O)ON=C1N |
| InChI | InChI=1S/C10H11N3O6S/c1-6(13-10(11)12-18-20(14,15)19-13)7-2-3-8-9(4-7)17-5-16-8/h2-4,6H,5H2,1H3,(H2,11,12) |
| InChIKey | XAYXNBYZBRKBOG-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |