C16H22N4O8S2 — CID 141046834
4,6,11,17-tetraamino-1,5,12,14,18-pentaoxo-13-oxa-8,9-dithiaspiro[6.11]octadecane-6-carboxylic acid (PubChem CID 141046834) has the molecular formula C16H22N4O8S2 and a molecular weight of 462.51 g/mol. Its IUPAC name is 4,6,11,17-tetraamino-1,5,12,14,18-pentaoxo-13-oxa-8,9-dithiaspiro[6.11]octadecane-6-carboxylic acid.
| Compound Name | 4,6,11,17-tetraamino-1,5,12,14,18-pentaoxo-13-oxa-8,9-dithiaspiro[6.11]octadecane-6-carboxylic acid |
|---|---|
| PubChem CID | 141046834 |
| Molecular Formula | C16H22N4O8S2 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 4,6,11,17-tetraamino-1,5,12,14,18-pentaoxo-13-oxa-8,9-dithiaspiro[6.11]octadecane-6-carboxylic acid |
| SMILES | NC1CSSC2(C(=O)CCC(N)C(=O)C2(N)C(=O)O)C(=O)C(N)CCC(=O)OC1=O |
| InChI | InChI=1S/C16H22N4O8S2/c17-6-1-3-9(21)16(15(20,11(6)23)14(26)27)12(24)7(18)2-4-10(22)28-13(25)8(19)5-29-30-16/h6-8H,1-5,17-20H2,(H,26,27) |
| InChIKey | QQWXEHPGSDTDJP-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 235.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|