C6H10N2O4S2Se — CID 141179999
trans-(5R,10R)-5,10-diamino-1,3-dioxa-7,8-dithia-2-selenacycloundecane-4,11-dione (PubChem CID 141179999) has the molecular formula C6H10N2O4S2Se and a molecular weight of 317.25 g/mol. Its IUPAC name is trans-(5R,10R)-5,10-diamino-1,3-dioxa-7,8-dithia-2-selenacycloundecane-4,11-dione.
| Compound Name | trans-(5R,10R)-5,10-diamino-1,3-dioxa-7,8-dithia-2-selenacycloundecane-4,11-dione |
|---|---|
| PubChem CID | 141179999 |
| Molecular Formula | C6H10N2O4S2Se |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.92 |
| IUPAC Name | trans-(5R,10R)-5,10-diamino-1,3-dioxa-7,8-dithia-2-selenacycloundecane-4,11-dione |
| SMILES | N[C@H]1CSSC[C@H](N)C(=O)O[Se]OC1=O |
| InChI | InChI=1S/C6H10N2O4S2Se/c7-3-1-13-14-2-4(8)6(10)12-15-11-5(3)9/h3-4H,1-2,7-8H2/t3-,4-/m0/s1 |
| InChIKey | ITZFWESLCOJNRV-IMJSIDKUSA-N |
| XLogP | -1.34 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|