C8H12N2O4S2 — CID 141083855
2,7-diamino-8-oxo-9-oxa-4,5-dithiaspiro[2.7]decane-2-carboxylic acid (PubChem CID 141083855) has the molecular formula C8H12N2O4S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2,7-diamino-8-oxo-9-oxa-4,5-dithiaspiro[2.7]decane-2-carboxylic acid.
| Compound Name | 2,7-diamino-8-oxo-9-oxa-4,5-dithiaspiro[2.7]decane-2-carboxylic acid |
|---|---|
| PubChem CID | 141083855 |
| Molecular Formula | C8H12N2O4S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2,7-diamino-8-oxo-9-oxa-4,5-dithiaspiro[2.7]decane-2-carboxylic acid |
| SMILES | NC1CSSC2(COC1=O)CC2(N)C(=O)O |
| InChI | InChI=1S/C8H12N2O4S2/c9-4-1-15-16-7(3-14-5(4)11)2-8(7,10)6(12)13/h4H,1-3,9-10H2,(H,12,13) |
| InChIKey | NARSHIWTSWLTDO-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|