About diazanium;1-hydroxypropylazanium;trihydroxide
diazanium;1-hydroxypropylazanium;trihydroxide (PubChem CID 141052061) has the molecular formula C3H21N3O4
and a molecular weight of 163.22 g/mol. Its IUPAC name is diazanium;1-hydroxypropylazanium;trihydroxide.
Molecular Properties
| Compound Name | diazanium;1-hydroxypropylazanium;trihydroxide |
| PubChem CID | 141052061 |
| Molecular Formula | C3H21N3O4 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.15 |
| IUPAC Name | diazanium;1-hydroxypropylazanium;trihydroxide |
| SMILES | CCC([NH3+])O.[NH4+].[NH4+].[OH-].[OH-].[OH-] |
| InChI | InChI=1S/C3H9NO.2H3N.3H2O/c1-2-3(4)5;;;;;/h3,5H,2,4H2,1H3;2*1H3;3*1H2 |
| InChIKey | DOROCQRHRLMPST-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 210.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze diazanium;1-hydroxypropylazanium;trihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;1-hydroxypropylazanium;trihydroxide?
The IUPAC name of diazanium;1-hydroxypropylazanium;trihydroxide (CID 141052061) is diazanium;1-hydroxypropylazanium;trihydroxide.
What is the SMILES notation for diazanium;1-hydroxypropylazanium;trihydroxide?
The canonical SMILES for diazanium;1-hydroxypropylazanium;trihydroxide is CCC([NH3+])O.[NH4+].[NH4+].[OH-].[OH-].[OH-].
What is the InChIKey of diazanium;1-hydroxypropylazanium;trihydroxide?
The InChIKey is DOROCQRHRLMPST-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO.2H3N.3H2O/c1-2-3(4)5;;;;;/h3,5H,2,4H2,1H3;2*1H3;3*1H2.
What are the key properties of diazanium;1-hydroxypropylazanium;trihydroxide?
diazanium;1-hydroxypropylazanium;trihydroxide has a molecular weight of 163.22 g/mol, XLogP of -0.82, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;1-hydroxypropylazanium;trihydroxide is sourced from PubChem (CID 141052061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).